| Melting point |
108-111 °C(lit.) |
| Boiling point |
162 °C(lit.) |
| Density |
0.9140 (estimate) |
| refractive index |
1.4628 (estimate) |
| Flash point |
113 °F |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Chloroform (Sparingly), Methanol (Slightly) |
| Water Solubility |
Completely soluble in water |
| form |
powder to crystal |
| pka |
9.38±0.60(Predicted) |
| color |
White to Orange to Green |
| Sensitive |
Light Sensitive & Hygroscopic |
| InChI |
InChI=1/C6H14N2/c1-5-3-7-4-6(2)8-5/h5-8H,3-4H2,1-2H3/t5-,6+ |
| InChIKey |
IFNWESYYDINUHV-OLQVQODUNA-N |
| SMILES |
C[C@@H]1CNC[C@@H](N1)C |&1:1,5,r| |
| CAS DataBase Reference |
21655-48-1(CAS DataBase Reference) |
