(1-Bromoethyl)benzene
- Product Name(1-Bromoethyl)benzene
- CAS585-71-7
- MFC8H9Br
- MW185.06
- EINECS209-560-2
- MOL File585-71-7.mol
Chemical Properties
| Melting point | -65°C |
| Boiling point | 94 °C/16 mmHg (lit.) |
| Density | 1.356 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 179 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in alcohol, ether, and benzene. |
| form | Liquid |
| color | Clear yellow to brownish |
| Sensitive | Moisture Sensitive |
| BRN | 507210 |
| InChI | InChI=1S/C8H9Br/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | CRRUGYDDEMGVDY-UHFFFAOYSA-N |
| SMILES | C1(C(Br)C)=CC=CC=C1 |
| CAS DataBase Reference | 585-71-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, (1-bromoethyl)-(585-71-7) |
| EPA Substance Registry System | (1-Bromoethyl)benzene (585-71-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-24/25 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29036990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 585-71-7(Hazardous Substances Data) |