| Melting point |
66-69 °C(lit.) |
| Boiling point |
253.13°C (rough estimate) |
| Density |
0.9003 (rough estimate) |
| refractive index |
1.5050 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| Water Solubility |
Insoluble in water |
| form |
powder to crystal |
| pka |
15.32±0.10(Predicted) |
| color |
White to Almost white |
| BRN |
1855382 |
| Stability |
Stable. Incompatible with strong oxidizing agents, strong acids, acid halides. |
| InChI |
InChI=1S/C12H20O/c13-2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,13H,1-8H2 |
| InChIKey |
ZBIDZPHRNBZTLT-UHFFFAOYSA-N |
| SMILES |
C12(CCO)CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference |
6240-11-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
1-Adamantaneethanol(6240-11-5) |
