Ethyl (S)-2-(trifluoromethylsulfonyloxy)propionate
- Product NameEthyl (S)-2-(trifluoromethylsulfonyloxy)propionate
- CAS84028-88-6
- MFC6H9F3O5S
- MW250.19
- EINECS
- MOL File84028-88-6.mol
Chemical Properties
| Boiling point | 34 °C/0.005 mmHg (lit.) |
| Density | 1.342 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 174 °F |
| storage temp. | -20°C |
| form | Liquid |
| color | Clear to cloudy colorless to pink to brown |
| optical activity | [α]20/D 44°, neat |
| BRN | 3549394 |
| InChI | 1S/C6H9F3O5S/c1-3-13-5(10)4(2)14-15(11,12)6(7,8)9/h4H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | RYSBPHXTNVWICH-BYPYZUCNSA-N |
| SMILES | CCOC(=O)[C@H](C)OS(=O)(=O)C(F)(F)F |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |