4-(tert-Butyldimethylsilyloxy)phenol 9&
- Product Name4-(tert-Butyldimethylsilyloxy)phenol 9&
- CAS108534-47-0
- MFC12H20O2Si
- MW224.37
- EINECS
- MOL File108534-47-0.mol
Chemical Properties
| Melting point | 60-64 °C (lit.) |
| Boiling point | 266.4±23.0 °C(Predicted) |
| Density | 0.974±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| form | Powder |
| pka | 10.24±0.15(Predicted) |
| color | White to off-white |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | 1S/C12H20O2Si/c1-12(2,3)15(4,5)14-11-8-6-10(13)7-9-11/h6-9,13H,1-5H3 |
| InChIKey | KZTVHIZALLBXMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(O)cc1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| TSCA | No |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |
