p-Quaterphenyl
- Product Namep-Quaterphenyl
- CAS135-70-6
- MFC24H18
- MW306.4
- EINECS205-213-4
- MOL File135-70-6.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| Boiling point | 428 °C18 mm Hg(lit.) |
| Density | 1.1138 (estimate) |
| refractive index | 1.9130 (estimate) |
| Flash point | 428°C/18mm |
| storage temp. | Storage temp. 2-8°C |
| solubility | Hexanes (Slightly), Toluene (Slightly, Heated, Sonicated) |
| form | powder to crystal |
| color | White to Almost white |
| ex/em | λex 363, 348, 293 nm; λem 363 nm in cyclohexane |
| BRN | 1912745 |
| InChI | InChI=1S/C24H18/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H |
| InChIKey | GPRIERYVMZVKTC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(C3=CC=C(C4=CC=CC=C4)C=C3)C=C2)=CC=CC=C1 |
| CAS DataBase Reference | 135-70-6(CAS DataBase Reference) |
| NIST Chemistry Reference | p-Quaterphenyl(135-70-6) |
| EPA Substance Registry System | p-Quaterphenyl (135-70-6) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29029090 |