3-Bromo-2-butanone
- Product Name3-Bromo-2-butanone
- CAS814-75-5
- MFC4H7BrO
- MW151
- EINECS212-404-6
- MOL File814-75-5.mol
Chemical Properties
| Boiling point | 36 °C (11 mmHg) |
| Density | 1.416 g/mL at 25 °C |
| refractive index | 1.458-1.46 |
| Flash point | >100°C |
| storage temp. | Storage temp. 2-8°C |
| solubility | Miscible with dichloromethane. |
| form | Liquid |
| color | Clear light yellow to brown |
| BRN | 906773 |
| InChI | InChI=1S/C4H7BrO/c1-3(5)4(2)6/h3H,1-2H3 |
| InChIKey | BNBOUFHCTIFWHN-UHFFFAOYSA-N |
| SMILES | CC(=O)C(Br)C |
| CAS DataBase Reference | 814-75-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Butanone, 3-bromo- (814-75-5) |
Safety Information
| Hazard Codes | Xn,C |
| Risk Statements | 36/37/38-20/21/22-34-21/24-21/22 |
| Safety Statements | 36/37/39-26-45 |
| RIDADR | 1224 |
| WGK Germany | 2 |
| RTECS | EL7005000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |