(3-Bromoacetyl)coumarin
- Product Name(3-Bromoacetyl)coumarin
- CAS29310-88-1
- MFC11H7BrO3
- MW267.08
- EINECS
- MOL File29310-88-1.mol
Chemical Properties
| Melting point | 164-168 °C (lit.) |
| Boiling point | 424.6±45.0 °C(Predicted) |
| Density | 1.674±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| λmax | 363nm(MeOH)(lit.) |
| InChI | 1S/C11H7BrO3/c12-6-9(13)8-5-7-3-1-2-4-10(7)15-11(8)14/h1-5H,6H2 |
| InChIKey | NTYOLVNSXVYRTJ-UHFFFAOYSA-N |
| SMILES | BrCC(=O)C1=Cc2ccccc2OC1=O |
| CAS DataBase Reference | 29310-88-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2932209090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
