4,4'-Dimethylthiocarbanilide
- Product Name4,4'-Dimethylthiocarbanilide
- CAS621-01-2
- MFC15H16N2S
- MW256.37
- EINECS210-665-0
- MOL File621-01-2.mol
Chemical Properties
| Melting point | 182-184 °C (lit.) |
| Boiling point | 377.7±45.0 °C(Predicted) |
| Density | 1.219±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 12.34±0.70(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | 1S/C15H16N2S/c1-11-3-7-13(8-4-11)16-15(18)17-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H2,16,17,18) |
| InChIKey | ULNVBRUIKLYGDF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(C)cc2)cc1 |
| CAS DataBase Reference | 621-01-2(CAS DataBase Reference) |
Safety Information
| WGK Germany | 3 |
| RTECS | FE0875000 |
| HS Code | 2930.90.2900 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
