Tetra-n-pentylammonium chloride
- Product NameTetra-n-pentylammonium chloride
- CAS4965-17-7
- MFC20H44ClN
- MW334.03
- EINECS225-606-4
- MOL File4965-17-7.mol
Chemical Properties
| Melting point | ~195 °C |
| vapor density | 11.5 (vs air) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | almost transparency in Water |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 3573674 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C20H44N.ClH/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;/h5-20H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | SXAWRMKQZKPHNJ-UHFFFAOYSA-M |
| SMILES | [N+](CCCCC)(CCCCC)(CCCCC)CCCCC.[Cl-] |
| CAS DataBase Reference | 4965-17-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Pentanaminium, N,N,N-tripentyl-, chloride (4965-17-7) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2928 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | RZ9275000 |
| F | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Skin Corr. 1B Skin Sens. 1 |