| Melting point |
~195 °C |
| vapor density |
11.5 (vs air) |
| storage temp. |
Inert atmosphere,Room Temperature |
| Water Solubility |
almost transparency in Water |
| form |
powder to crystal |
| color |
White to Almost white |
| BRN |
3573674 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C20H44N.ClH/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;/h5-20H2,1-4H3;1H/q+1;/p-1 |
| InChIKey |
SXAWRMKQZKPHNJ-UHFFFAOYSA-M |
| SMILES |
[N+](CCCCC)(CCCCC)(CCCCC)CCCCC.[Cl-] |
| CAS DataBase Reference |
4965-17-7(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Pentanaminium, N,N,N-tripentyl-, chloride (4965-17-7) |
