Tris[N,N-bis(trimethylsilyl)amide]yttrium (III)
- Product NameTris[N,N-bis(trimethylsilyl)amide]yttrium (III)
- CAS41836-28-6
- MFC6H19NSi2Y
- MW250.3
- EINECS
- MOL File41836-28-6.mol
Chemical Properties
| Melting point | 161-166 °C(lit.) |
| Boiling point | 105°C 10mm |
| Flash point | −10 °F |
| form | Powder |
| color | white to off-white |
| Water Solubility | Reacts violently with water. |
| Sensitive | Air & Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | 1S/3C6H18NSi2.Y/c3*1-8(2,3)7-9(4,5)6;/h3*1-6H3;/q3*-1;+3 |
| InChIKey | ALBMVGKOSBREQT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N([Y](N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
Safety Information
| Hazard Codes | F,C |
| Risk Statements | 11-14/15-34 |
| Safety Statements | 16-26-36/37/39-43-45-7/8 |
| RIDADR | UN 3396 4.3/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 4.1 |
| PackingGroup | III |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Flam. Sol. 1 Skin Corr. 1B Water-react 2 |