3,4,5-Trichlorophenol
- Product Name3,4,5-Trichlorophenol
- CAS609-19-8
- MFC6H3Cl3O
- MW197.45
- EINECS210-183-0
- MOL File609-19-8.mol
Chemical Properties
| Melting point | 118-119℃ |
| Boiling point | 275℃ |
| Density | 1.5701 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly, Heated) |
| pka | pK1:7.839 (25°C) |
| Appearance | Light brown to brown Solid |
| Henry's Law Constant | 4.3×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability | Stable. Probably combustible. Incompatible with strong oxidizing agents, acid chlorides, acid anhydrides. |
| Major Application | environmental |
| InChI | InChI=1S/C6H3Cl3O/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H |
| InChIKey | GBNHEBQXJVDXSW-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(Cl)=C(Cl)C(Cl)=C1 |
| EPA Substance Registry System | 3,4,5-Trichlorophenol (609-19-8) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-36/37/38-50/53-41-37/38 |
| Safety Statements | 26-36-61-60 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | SN1650000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 609-19-8(Hazardous Substances Data) |