| Melting point |
159°C |
| Boiling point |
423.4±47.0 °C(Predicted) |
| Density |
1.4374 (rough estimate) |
| vapor pressure |
0.001Pa at 20℃ |
| refractive index |
1.5364 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Insoluble in water |
| form |
powder to crystal |
| pka |
3.23±0.10(Predicted) |
| color |
White to Light yellow |
| Water Solubility |
133mg/L at 20℃ |
| InChI |
InChI=1S/C9H7NO2S2/c11-8(12)5-13-9-10-6-3-1-2-4-7(6)14-9/h1-4H,5H2,(H,11,12) |
| InChIKey |
ZZUQWNYNSKJLPI-UHFFFAOYSA-N |
| SMILES |
C(O)(=O)CSC1=NC2=CC=CC=C2S1 |
| LogP |
1.6 at 20℃ |
| CAS DataBase Reference |
6295-57-4(CAS DataBase Reference) |
| EPA Substance Registry System |
Acetic acid, (2-benzothiazolylthio)- (6295-57-4) |
