Ethyl 3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate
- Product NameEthyl 3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate
- CAS141573-95-7
- MFC8H10F2N2O2
- MW204.17
- EINECS619-510-5
- MOL File141573-95-7.mol
Chemical Properties
| Melting point | 58-59 °C |
| Boiling point | 288.4±40.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -2.00±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | 4.63g/L at 22℃ |
| InChI | InChI=1S/C8H10F2N2O2/c1-3-14-8(13)5-4-12(2)11-6(5)7(9)10/h4,7H,3H2,1-2H3 |
| InChIKey | MRQQMVMIANXDKC-UHFFFAOYSA-N |
| SMILES | N1(C)C=C(C(OCC)=O)C(C(F)F)=N1 |
