Melting point |
201-203°C |
Boiling point |
315.9±42.0 °C(Predicted) |
Density |
1.52 |
vapor pressure |
0-0.397Pa at 20-99.7℃ |
storage temp. |
Sealed in dry,Room Temperature |
solubility |
DMSO (Slightly), Methanol (Sparingly) |
pka |
3.12±0.36(Predicted) |
form |
Solid |
color |
White to Off-White |
InChI |
InChI=1S/C6H6F2N2O2/c1-10-2-3(6(11)12)4(9-10)5(7)8/h2,5H,1H3,(H,11,12) |
InChIKey |
RLOHOBNEYHBZID-UHFFFAOYSA-N |
SMILES |
N1(C)C=C(C(O)=O)C(C(F)F)=N1 |
LogP |
-2.2-0.64 at 20-23℃ and pH2-7.1 |
Surface tension |
70.7mN/m at 1g/L and 20℃ |
Dissociation constant |
3.12-3.89 at 20℃ |
EPA Substance Registry System |
1H-Pyrazole-4-carboxylic acid, 3-(difluoromethyl)-1-methyl- (176969-34-9) |