(+/-)-11-Nor-9-carboxy-delta9-thc
- Product Name(+/-)-11-Nor-9-carboxy-delta9-thc
- CAS104874-50-2
- MFC21H28O4
- MW344.45
- EINECS200-659-6
- MOL File104874-50-2.mol
Chemical Properties
| Melting point | 174-176 °C |
| Boiling point | 466.9±45.0 °C(Predicted) |
| Density | 1.140±0.06 g/cm3(Predicted) |
| Flash point | 9℃ |
| storage temp. | −20°C |
| pka | 4.66±0.40(Predicted) |
| form | vacuum-dried powder |
| color | Colorless to light yellow |
| Major Application | cannabis testing forensics and toxicology |
| InChI | 1S/C21H28O4/c1-4-5-6-7-13-10-17(22)19-15-12-14(20(23)24)8-9-16(15)21(2,3)25-18(19)11-13/h10-12,15-16,22H,4-9H2,1-3H3,(H,23,24) |
| InChIKey | YOVRGSHRZRJTLZ-UHFFFAOYSA-N |
| SMILES | CCCCCc1cc(O)c2C3C=C(CCC3C(C)(C)Oc2c1)C(O)=O |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |