1,4-Benzenebisphosphonic acid
- Product Name1,4-Benzenebisphosphonic acid
- CAS880-68-2
- MFC6H8O6P2
- MW238.07
- EINECS
- MOL File880-68-2.mol
Chemical Properties
| Melting point | 275 °C |
| Boiling point | 580.4±60.0 °C(Predicted) |
| Density | 1.80±0.1 g/cm3(Predicted) |
| pka | 1.28±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C6H8O6P2/c7-13(8,9)5-1-2-6(4-3-5)14(10,11)12/h1-4H,(H2,7,8,9)(H2,10,11,12) |
| InChIKey | JHDJUJAFXNIIIW-UHFFFAOYSA-N |
| SMILES | [P](=O)(O)(O)c1ccc(cc1)[P](=O)(O)O |
Safety Information
| RIDADR | UN 3261 8/PG III |
| WGK Germany | WGK 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2931499090 |
| Storage Class | 11 - Combustible Solids |
