2-Nitro-5-(phenylacetylamino)-benzoic acid
- Product Name2-Nitro-5-(phenylacetylamino)-benzoic acid
- CAS52033-70-2
- MFC15H12N2O5
- MW300.27
- EINECS
- MOL File52033-70-2.mol
Chemical Properties
| Boiling point | 599.6±50.0 °C(Predicted) |
| Density | 1.446±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | ethanol: 9.80-10.20mg/mL, clear, faintly yellow to yellow |
| form | powder |
| pka | 2.05±0.25(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | 1S/C15H12N2O5/c18-14(8-10-4-2-1-3-5-10)16-11-6-7-13(17(21)22)12(9-11)15(19)20/h1-7,9H,8H2,(H,16,18)(H,19,20) |
| InChIKey | QHVQEQRGDKOHHC-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(NC(=O)Cc2ccccc2)ccc1[N+]([O-])=O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
