1-Fluorenecarboxylic acid
- Product Name1-Fluorenecarboxylic acid
- CAS6276-03-5
- MFC14H10O2
- MW210.23
- EINECS228-472-5
- MOL File6276-03-5.mol
Chemical Properties
| Melting point | 246-248 °C (lit.) |
| Boiling point | 100 °C / 12mmHg |
| Density | 1.306±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Tetrahydrofuran |
| form | powder to crystal |
| pka | 4.11±0.20(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | 1S/C14H10O2/c15-14(16)12-7-3-6-11-10-5-2-1-4-9(10)8-13(11)12/h1-7H,8H2,(H,15,16) |
| InChIKey | HTPXFGUCAUTOEL-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc-2c1Cc3ccccc-23 |
| CAS DataBase Reference | 6276-03-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |