N-(2-Hydroxyethyl)iminodiacetic acid
- Product NameN-(2-Hydroxyethyl)iminodiacetic acid
- CAS93-62-9
- MFC6H11NO5
- MW177.16
- EINECS202-263-9
- MOL File93-62-9.mol
Chemical Properties
| Melting point | 178 °C (lit.) |
| Boiling point | 309.06°C (rough estimate) |
| Density | 1.4347 (rough estimate) |
| vapor pressure | 8.398hPa at 21.1℃ |
| refractive index | 1.4230 (estimate) |
| storage temp. | 2-8°C, protect from light |
| solubility | 0.1 M NaOH: 50 mg/mL, clear |
| pka | pK1:2.2;pK2:8.65 (25°C,μ=0.1) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | 18.61g/L at 25℃ |
| BRN | 1780628 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H11NO5/c8-2-1-7(3-5(9)10)4-6(11)12/h8H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | JYXGIOKAKDAARW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(CC(O)=O)CCO |
| LogP | -1.17 at 25℃ |
| CAS DataBase Reference | 93-62-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AI1925000 |
| TSCA | TSCA listed |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |