2,3,4,5,6-Pentafluorobenzeneboronic acid
- Product Name2,3,4,5,6-Pentafluorobenzeneboronic acid
- CAS1582-24-7
- MFC6H2BF5O2
- MW211.88
- EINECS627-867-3
- MOL File1582-24-7.mol
Chemical Properties
| Melting point | 176-179°C |
| Boiling point | 244.0±50.0 °C(Predicted) |
| Density | 1.61±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Miscible with alcohols, acetonitrile and dichloromethane. |
| pka | 6.13±0.58(Predicted) |
| form | powder |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 3033960 |
| InChI | InChI=1S/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
| InChIKey | VASOMTXTRMYSKD-UHFFFAOYSA-N |
| SMILES | B(C1=C(F)C(F)=C(F)C(F)=C1F)(O)O |
| CAS DataBase Reference | 1582-24-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |