(2S,5S)-(-)-2-tert-Butyl-3-methyl-5-benzyl-4-imidazolidinone
- Product Name(2S,5S)-(-)-2-tert-Butyl-3-methyl-5-benzyl-4-imidazolidinone
- CAS346440-54-8
- MFC15H22N2O
- MW246.35
- EINECS
- MOL File346440-54-8.mol
Chemical Properties
| Melting point | 93-100 °C(lit.) |
| Boiling point | 378.0±35.0 °C(Predicted) |
| Density | 1.040±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 5.59±0.60(Predicted) |
| color | White to Light yellow |
| optical activity | -71.30°(C=0.88g/100mI, CHCL3, 20°C, 589nm) |
| InChI | 1S/C15H22N2O/c1-15(2,3)14-16-12(13(18)17(14)4)10-11-8-6-5-7-9-11/h5-9,12,14,16H,10H2,1-4H3/t12-,14-/m0/s1 |
| InChIKey | SKHPYKHVYFTIOI-JSGCOSHPSA-N |
| SMILES | CN1[C@H](N[C@@H](Cc2ccccc2)C1=O)C(C)(C)C |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
