4-(4-Bromophenyl)-4-piperidinol
- Product Name 4-(4-Bromophenyl)-4-piperidinol
- CAS57988-58-6
- MFC11H14BrNO
- MW256.14
- EINECS261-065-0
- MOL File57988-58-6.mol
Chemical Properties
| Melting point | 167-170 °C (lit.) |
| Boiling point | 361.0±42.0 °C(Predicted) |
| Density | 1.4066 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder to crystal |
| pka | 13.92±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C11H14BrNO/c12-10-3-1-9(2-4-10)11(14)5-7-13-8-6-11/h1-4,13-14H,5-8H2 |
| InChIKey | QNLXJYQUWCNYBH-UHFFFAOYSA-N |
| SMILES | N1CCC(C2=CC=C(Br)C=C2)(O)CC1 |
| CAS DataBase Reference | 57988-58-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
