OLEANDRIN
- Product NameOLEANDRIN
- CAS465-16-7
- MFC32H48O9
- MW576.72
- EINECS207-361-5
- MOL File465-16-7.mol
Chemical Properties
| Melting point | 250°C |
| alpha | D25 -48.0° (c = 1.3 in methanol) |
| Boiling point | 557.17°C (rough estimate) |
| Density | 1.26 |
| refractive index | 1.5000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 15 mg/ml; DMF:PBS (pH 7.2) (1:4): 0.2 mg/ml; DMSO: 10 mg/ml; Ethanol: 5 mg/ml |
| form | A solid |
| pka | 13.55±0.70(Predicted) |
| color | Crystals from dil methanol |
| Major Application | food and beverages |
| InChIKey | JLPDBLFIVFSOCC-PDVPYGGCNA-N |
| SMILES | CO[C@H]1C[C@@H](O[C@@H](C)[C@@H]1O)O[C@H]2CC[C@@]3(C)C(CCC4C3CC[C@]5(C)[C@H]([C@H](C[C@]45O)OC(C)=O)C6=CC(=O)OC6)C2 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-33-23/25 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | FH4585000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral STOT RE 2 |
| Hazardous Substances Data | 465-16-7(Hazardous Substances Data) |
| Toxicity | LD50 ivn-cat: 300 mg/kg MEIEDD 10,979,83 |
