Benzyl benzodithioate
- Product NameBenzyl benzodithioate
- CAS27249-90-7
- MFC14H12S2
- MW244.38
- EINECS
- MOL File27249-90-7.mol
Chemical Properties
| Melting point | 55℃ |
| Boiling point | 373℃ |
| Density | 1.200 |
| refractive index | n20/D1.696 |
| Flash point | 179℃ |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Orange to Brown to Dark red |
| InChI | InChI=1S/C14H12S2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | ZCKPFAYILJKXAT-UHFFFAOYSA-N |
| SMILES | C1(C(=S)SCC2=CC=CC=C2)=CC=CC=C1 |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2930.90.2900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |