Diisopropyl phthalate
- Product NameDiisopropyl phthalate
- CAS605-45-8
- MFC14H18O4
- MW250.29
- EINECS210-086-3
- MOL File605-45-8.mol
Chemical Properties
| Melting point | 20 °C |
| Boiling point | 313.42°C (rough estimate) |
| Density | 1.063 g/mL at 20 °C (lit.) |
| refractive index | n 20/D 1.490 (lit.) |
| Flash point | Not applicable |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| Water Solubility | 332.9mg/L(20 ºC) |
| BRN | 1972723 |
| Major Application | environmental |
| InChI | 1S/C14H18O4/c1-9(2)17-13(15)11-7-5-6-8-12(11)14(16)18-10(3)4/h5-10H,1-4H3 |
| InChIKey | QWDBCIAVABMJPP-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1ccccc1C(=O)OC(C)C |
| EPA Substance Registry System | Diisopropyl phthalate (605-45-8) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | TI1350000 |
| TSCA | TSCA listed |
| HS Code | 2917.34.0150 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
