Benzo(j)fluoranthene
- Product NameBenzo(j)fluoranthene
- CAS205-82-3
- MFC20H12
- MW252.31
- EINECS205-910-3
- MOL File205-82-3.mol
Chemical Properties
| Melting point | 166°C |
| Boiling point | 330.49°C (rough estimate) |
| Density | 1.1549 (estimate) |
| refractive index | 1.8390 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White |
| Water Solubility | 2.5ug/L(temperature not stated) |
| Henry's Law Constant | 4.9×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | InChI=1S/C20H12/c1-2-8-15-13(5-1)11-12-17-16-9-3-6-14-7-4-10-18(19(14)16)20(15)17/h1-12H |
| InChIKey | KHNYNFUTFKJLDD-UHFFFAOYSA-N |
| SMILES | C1=C2C3=C(C4=C2C=CC2=CC=CC=C42)C=CC=C3C=C1 |
| IARC | 2B (Vol. 92) 2010 |
| EPA Substance Registry System | Benzo[j]fluoranthene (205-82-3) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 45-50/53-63-43-36/37/38-23/24/25-67-52/53 |
| Safety Statements | 45-53-61-60-36/37-24/25-23-26 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Hazard Classifications | Aquatic Chronic 3 Carc. 1B Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 205-82-3(Hazardous Substances Data) |