2,3-Dibromobenzo[b]thiophene
- Product Name2,3-Dibromobenzo[b]thiophene
- CAS6287-82-7
- MFC8H4Br2S
- MW291.99
- EINECS
- MOL File6287-82-7.mol
Chemical Properties
| Melting point | 58-62 °C(lit.) |
| Boiling point | 345.1±22.0 °C(Predicted) |
| Density | 2.008±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow to Dark green |
| InChI | InChI=1S/C8H4Br2S/c9-7-5-3-1-2-4-6(5)11-8(7)10/h1-4H |
| InChIKey | TWZSIAFEFBKCNN-UHFFFAOYSA-N |
| SMILES | C12=CC=CC=C1C(Br)=C(Br)S2 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-36 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 4 Eye Irrit. 2 |