(1S)-(+)-CAMPHORQUINONE
- Product Name(1S)-(+)-CAMPHORQUINONE
- CAS2767-84-2
- MFC10H14O2
- MW166.22
- EINECS220-446-1
- MOL File2767-84-2.mol
Chemical Properties
| Melting point | 197-201 °C(lit.) |
| Boiling point | 234.44°C (rough estimate) |
| alpha | +100° (20/D)(c=1.9, C6H5CH3) |
| Density | 0.9817 (rough estimate) |
| refractive index | 1.4859 (estimate) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| optical activity | [α]20/D +100°, c = 1.9 in toluene |
| BRN | 2613999 |
| InChI | 1S/C10H14O2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6H,4-5H2,1-3H3/t6-,10+/m0/s1 |
| InChIKey | VNQXSTWCDUXYEZ-QUBYGPBYSA-N |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)C2=O |
| CAS DataBase Reference | 2767-84-2(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[2.2.1]heptane-2,3-dione, 1,7,7-trimethyl-, (1S,4R)- (2767-84-2) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29142900 |
| Storage Class | 11 - Combustible Solids |
