3-(Dansylamino)phenylboronic acid
- Product Name3-(Dansylamino)phenylboronic acid
- CAS75806-94-9
- MFC18H19BN2O4S
- MW370.23
- EINECS278-319-1
- MOL File75806-94-9.mol
Chemical Properties
| Boiling point | 599.3±60.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 7.81±0.10(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| Appearance | Solid Powder |
| BRN | 8012268 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C18H19BN2O4S/c1-21(2)17-10-4-9-16-15(17)8-5-11-18(16)26(24,25)20-14-7-3-6-13(12-14)19(22)23/h3-12,20,22-23H,1-2H3 |
| InChIKey | TYXMKSYBCDTGDU-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(cccc12)S(=O)(=O)Nc3cccc(c3)B(O)O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25-22 |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |