3-(2',4'-Difluorobenzoyl)propionic acid
- Product Name3-(2',4'-Difluorobenzoyl)propionic acid
- CAS110931-77-6
- MFC10H8F2O3
- MW214.17
- EINECS
- MOL File110931-77-6.mol
Chemical Properties
| Melting point | 115.0 to 119.0 °C |
| Boiling point | 366.7±32.0 °C(Predicted) |
| Density | 1.363 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.33±0.17(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C10H8F2O3/c11-6-1-2-7(8(12)5-6)9(13)3-4-10(14)15/h1-2,5H,3-4H2,(H,14,15) |
| InChIKey | OKYUHFSCTFNDFB-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(F)=CC=1F)(=O)CCC(=O)O |
| CAS DataBase Reference | 110931-77-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| HS Code | 2915601990 |
