2,3-Dicyanonaphthalene
- Product Name2,3-Dicyanonaphthalene
- CAS22856-30-0
- MFC12H6N2
- MW178.19
- EINECS
- MOL File22856-30-0.mol
Chemical Properties
| Melting point | 253-257 °C |
| Boiling point | 300.41°C (rough estimate) |
| Density | 1.2218 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | slightly sol. in Chloroform |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2574929 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C12H6N2/c13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14/h1-6H |
| InChIKey | KNBYJRSSFXTESR-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(C#N)=C1C#N |
| CAS DataBase Reference | 22856-30-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37-37/39-26 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |