2-Acetyl-5-chlorothiophene
- Product Name2-Acetyl-5-chlorothiophene
- CAS6310-09-4
- MFC6H5ClOS
- MW160.62
- EINECS228-630-3
- MOL File6310-09-4.mol
Chemical Properties
| Melting point | 46-49 °C (lit.) |
| Boiling point | 117-118 °C/17 mmHg (lit.) |
| Density | 1.3240 (estimate) |
| Flash point | 227 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystals or Crystalline Powder |
| color | White to light yellow |
| Sensitive | Light Sensitive |
| BRN | 113936 |
| InChI | InChI=1S/C6H5ClOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| InChIKey | HTZGPEHWQCRXGZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1SC(Cl)=CC=1)C |
| CAS DataBase Reference | 6310-09-4(CAS DataBase Reference) |
Safety Information
| Risk Statements | 20/21/22 |
| Safety Statements | 24/25-36/37 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | OB1745000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 |
