Benzoin ethyl ether
- Product NameBenzoin ethyl ether
- CAS574-09-4
- MFC16H16O2
- MW240.3
- EINECS209-366-8
- MOL File574-09-4.mol
Chemical Properties
| Melting point | 59-61 °C(lit.) |
| Boiling point | 194-195°C 20mm |
| Density | 1.1016 |
| refractive index | 1.5727 |
| Flash point | 194-195°C/20mm |
| storage temp. | Store below +30°C. |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 14,1093 |
| BRN | 2053926 |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | InChI=1S/C16H16O2/c1-2-18-16(14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12,16H,2H2,1H3 |
| InChIKey | KMNCBSZOIQAUFX-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1)C(OCC)C1=CC=CC=C1 |
| CAS DataBase Reference | 574-09-4(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanone, 2-ethoxy-1,2-diphenyl- (574-09-4) |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HS Code | 2914 50 00 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |