2-Phenylindole-3-carboxaldehyde
- Product Name2-Phenylindole-3-carboxaldehyde
- CAS25365-71-3
- MFC15H11NO
- MW221.25
- EINECS
- MOL File25365-71-3.mol
Chemical Properties
| Melting point | 249-253 °C (lit.) |
| Boiling point | 462.9±33.0 °C(Predicted) |
| Density | 1.237±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 15.30±0.30(Predicted) |
| color | White to Brown |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C15H11NO/c17-10-13-12-8-4-5-9-14(12)16-15(13)11-6-2-1-3-7-11/h1-10,16H |
| InChIKey | IFIFXODAHZPTEY-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C=O)=C1C1=CC=CC=C1 |
| CAS DataBase Reference | 25365-71-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
