4-tert-Octylphenol Diethoxylate-13C6
- Product Name4-tert-Octylphenol Diethoxylate-13C6
- CAS1173020-69-3
- MFC18H30O3
- MW294.429
- EINECS688-189-1
- MOL File1173020-69-3.mol
Chemical Properties
| Flash point | -17℃ |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil to Low-Melting Solid |
| color | Colourless to Off-White |
| Major Application | environmental |
| InChI | 1S/C18H30O3/c1-17(2,3)14-18(4,5)15-6-8-16(9-7-15)21-13-12-20-11-10-19/h6-9,19H,10-14H2,1-5H3/i6+1,7+1,8+1,9+1,15+1,16+1 |
| InChIKey | LBCZOTMMGHGTPH-CJFYFUKZSA-N |
| SMILES | CC(C)(C)CC(C)(C)[13c]1[13cH][13cH][13c](OCCOCCO)[13cH][13cH]1 |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-36-52/53-66-67 |
| Safety Statements | 16-26-61-9 |
| RIDADR | UN1090 - class 3 - PG 2 - Acetone, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |