1-Phenyloxindole
- Product Name1-Phenyloxindole
- CAS3335-98-6
- MFC14H11NO
- MW209.24
- EINECS441-020-3
- MOL File3335-98-6.mol
Chemical Properties
| Melting point | 123-125 |
| Boiling point | 443.6±25.0 °C(Predicted) |
| Density | 1.228±0.06 g/cm3(Predicted) |
| vapor pressure | 0.002Pa at 20℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Practically insoluble in water |
| form | powder to crystal |
| pka | -3.41±0.20(Predicted) |
| color | White to Light yellow |
| Water Solubility | 74.3mg/L at 20℃ |
| InChI | InChI=1S/C14H11NO/c16-14-10-11-6-4-5-9-13(11)15(14)12-7-2-1-3-8-12/h1-9H,10H2 |
| InChIKey | OWPNVXATCSXTBK-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)C2=C(C=CC=C2)CC1=O |
| LogP | 2.6 at 26℃ |
| CAS DataBase Reference | 3335-98-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2933790090 |
