3-Aminopyrazine-2-carboxylic acid
- Product Name3-Aminopyrazine-2-carboxylic acid
- CAS5424-01-1
- MFC5H5N3O2
- MW139.11
- EINECS226-558-7
- MOL File5424-01-1.mol
Chemical Properties
| Melting point | 205-210 °C (dec.) (lit.) |
| Boiling point | 255.04°C (rough estimate) |
| Density | 1.4551 (rough estimate) |
| refractive index | 1.5900 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly) , Methanol (Slightly) |
| pka | 3.65±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow-greenish |
| BRN | 124835 |
| InChI | InChI=1S/C5H5N3O2/c6-4-3(5(9)10)7-1-2-8-4/h1-2H,(H2,6,8)(H,9,10) |
| InChIKey | ZAGZIOYVEIDDJA-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=CN=C1N |
| LogP | -3.1 at 20℃ and pH7 |
| Surface tension | 73.6mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 5424-01-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |