alpha-Phenylcinnamic acid
- Product Namealpha-Phenylcinnamic acid
- CAS91-48-5
- MFC15H12O2
- MW224.26
- EINECS202-069-4
- MOL File91-48-5.mol
Chemical Properties
| Melting point | 172-174 °C(lit.) |
| Boiling point | 325.66°C (rough estimate) |
| Density | 1.198 |
| refractive index | 1.6530 (estimate) |
| pka | 4.8 in 60% ethanol |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 14,7281 |
| BRN | 1911342 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C15H12O2/c16-15(17)14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,(H,16,17)/b14-11+ |
| InChIKey | BIDDLDNGQCUOJQ-SDNWHVSQSA-N |
| SMILES | OC(=O)\C(=C\c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 91-48-5(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 13 - Non Combustible Solids |