2,2',4,4',5-Pentabromodiphenyl ether
- Product Name2,2',4,4',5-Pentabromodiphenyl ether
- CAS60348-60-9
- MFC12H5Br5O
- MW564.69
- EINECS208-759-1
- MOL File60348-60-9.mol
Chemical Properties
| Melting point | 84-85 °C(Solv: tetrahydrofuran (109-99-9); water (7732-18-5); acetonitrile (75-05-8)) |
| Boiling point | 416 °C |
| Density | 2.343±0.06 g/cm3(Predicted) |
| Flash point | -12 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly, Heated) |
| form | Semi-Solid to Solid |
| color | White to Pale Pink |
| Henry's Law Constant | 1.5×100 mol/(m3Pa) at 25℃, Long et al. (2017) |
| Stability | Light Sensitive |
| Major Application | environmental |
| InChI | 1S/C12H5Br5O/c13-6-1-2-11(9(16)3-6)18-12-5-8(15)7(14)4-10(12)17/h1-5H |
| InChIKey | WHPVYXDFIXRKLN-UHFFFAOYSA-N |
| SMILES | BrC1=C(OC2=CC(Br)=C(Br)C=C2Br)C=CC(Br)=C1 |
| EPA Substance Registry System | Benzene, 1,2,4-tribromo-5-(2,4-dibromophenoxy)- (60348-60-9) |
Safety Information
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-38-50/53-65-67 |
| Safety Statements | 60-61-62-33-29-16-9 |
| RIDADR | UN 1262 3/PG 2 |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |