3-Iodophenylacetonitrile
- Product Name3-Iodophenylacetonitrile
- CAS130723-54-5
- MFC8H6IN
- MW243.04
- EINECS626-941-2
- MOL File130723-54-5.mol
Chemical Properties
| Melting point | 34-38 °C(lit.) |
| Boiling point | 138°C 12mm |
| Flash point | 138°C/12mm |
| storage temp. | 2-8°C(protect from light) |
| solubility | soluble in Methanol |
| form | powder to lump |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water |
| Sensitive | Light Sensitive |
| BRN | 7350695 |
| InChI | InChI=1S/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 |
| InChIKey | LVOKGAHCTHNWIL-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=CC(I)=C1 |
| CAS DataBase Reference | 130723-54-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-21/22 |
| Safety Statements | 36/37 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HS Code | 2926.90.4801 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral |