1,2,7,8-Diepoxyoctane
- Product Name1,2,7,8-Diepoxyoctane
- CAS2426-07-5
- MFC8H14O2
- MW142.2
- EINECS219-375-9
- MOL File2426-07-5.mol
Chemical Properties
| Melting point | 7°C |
| Boiling point | 240 °C(lit.) |
| Density | 0.997 g/mL at 25 °C(lit.) |
| vapor pressure | <1 hPa ( 20 °C) |
| refractive index | n |
| Flash point | 208 °F |
| storage temp. | Store below +30°C. |
| solubility | 7g/l |
| form | clear liquid |
| Specific Gravity | 0.991.997 |
| color | Colorless to Light yellow |
| Water Solubility | Soluble in water (partly miscible), acetone and heptane. |
| BRN | 104873 |
| InChI | InChI=1S/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2 |
| InChIKey | LFKLPJRVSHJZPL-UHFFFAOYSA-N |
| SMILES | C(C1CO1)CCCC1CO1 |
| CAS DataBase Reference | 2426-07-5(CAS DataBase Reference) |
| EPA Substance Registry System | Oxirane, 2,2'-(1,4-butanediyl)bis- (2426-07-5) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 22-24-68-45 |
| Safety Statements | 36/37/39-45-53 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | RG9450000 |
| Autoignition Temperature | 350°C (DIN 51794) |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29109000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Carc. 1B Muta. 2 |
