(R,S)-N-Nitrosoanabasine
- Product Name(R,S)-N-Nitrosoanabasine
- CAS1133-64-8
- MFC10H13N3O
- MW191.23
- EINECS200-659-6
- MOL File1133-64-8.mol
Chemical Properties
| Boiling point | 326.98°C (rough estimate) |
| Density | 1.1311 (rough estimate) |
| refractive index | 1.4830 (estimate) |
| Flash point | 9℃ |
| storage temp. | -20°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil to Low-Melting Solid |
| pka | 5.49±0.12(Predicted) |
| color | Light Yellow to Yellow |
| Major Application | forensics and toxicology |
| InChI | InChI=1S/C10H13N3O/c14-12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h3-4,6,8,10H,1-2,5,7H2/t10-/m0/s1 |
| InChIKey | BXYPVKMROLGXJI-JTQLQIEISA-N |
| SMILES | C1=NC=CC=C1[C@@H]1CCCCN1N=O |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |