(4-Chlorophenylethynyl)trimethylsilane
- Product Name(4-Chlorophenylethynyl)trimethylsilane
- CAS78704-49-1
- MFC11H13ClSi
- MW208.76
- EINECS
- MOL File78704-49-1.mol
Chemical Properties
| Melting point | 47-51 °C(lit.) |
| Boiling point | 231.2±32.0℃ (760 Torr) |
| Density | 1.03±0.1 g/cm3 (20 ºC 760 Torr) |
| Flash point | 220 °F |
| storage temp. | Store at room temperature |
| form | Solid |
| color | White to pale brown |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/C11H13ClSi/c1-13(2,3)9-8-10-4-6-11(12)7-5-10/h4-7H,1-3H3 |
| InChIKey | HVIHXUCWKNRJTC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#Cc1ccc(Cl)cc1 |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |