2-Fluoro-6-(trifluoromethyl)benzyl bromide
- Product Name2-Fluoro-6-(trifluoromethyl)benzyl bromide
- CAS239087-08-2
- MFC8H5BrF4
- MW257.02
- EINECS627-330-3
- MOL File239087-08-2.mol
Chemical Properties
| Melting point | 38-42 °C (lit.) |
| Boiling point | 186℃ |
| Density | 1.640 |
| Flash point | 225 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C8H5BrF4/c9-4-5-6(8(11,12)13)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | RINUERVPFANASB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(C(F)(F)F)=C1CBr |
| CAS DataBase Reference | 239087-08-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39 |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
