1-Triisopropylsilyl-1-propyne
- Product Name1-Triisopropylsilyl-1-propyne
- CAS82192-57-2
- MFC12H24Si
- MW196.41
- EINECS
- MOL File82192-57-2.mol
Chemical Properties
| Boiling point | 70 °C / 1mmHg |
| Density | 0.82 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 160 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.88 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/C12H24Si/c1-8-9-13(10(2)3,11(4)5)12(6)7/h10-12H,1-7H3 |
| InChIKey | FDEZWWXTHRGNJD-UHFFFAOYSA-N |
| SMILES | CC#C[Si](C(C)C)(C(C)C)C(C)C |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2931.90.9010 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |