4-Bromomethyl-7-methoxycoumarin
- Product Name4-Bromomethyl-7-methoxycoumarin
- CAS35231-44-8
- MFC11H9BrO3
- MW269.09
- EINECS252-448-3
- MOL File35231-44-8.mol
Chemical Properties
| Melting point | 213-215 °C (lit.) |
| Boiling point | 385.3±42.0 °C(Predicted) |
| Density | 1.552±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | chloroform: soluble20mg/mL, clear, colorless to faintly yellow |
| form | Powder and/or Chunks |
| color | Off-white to light yellow or beige |
| Water Solubility | insoluble |
| λmax | 330 nm (MeOH) |
| BRN | 187211 |
| Stability | Stable, but moisture and light-sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | Detection of nitrated explosives; measuring ultraviolet ray power; photoacid generators; polyurethane foams; photoresists silica nanoparticles |
| Biological Applications | Analyzing/detecting carboxylic acids;analyzing/labeling fatty acids; detecting nitric oxide; detecting/separating bile acids; labeling pyrimidine nucleobases; anticancer agents; biomedical trace analysis; herbicides; as a substrate for measuring histone acetyltransferases (HATs) activity, peptidases activity, sirtuin activity |
| InChI | 1S/C11H9BrO3/c1-14-8-2-3-9-7(6-12)4-11(13)15-10(9)5-8/h2-5H,6H2,1H3 |
| InChIKey | CTENSLORRMFPDH-UHFFFAOYSA-N |
| SMILES | COc1ccc2C(CBr)=CC(=O)Oc2c1 |
| LogP | 2.730 (est) |
| CAS DataBase Reference | 35231-44-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |