(N,N-Diethyl-3-aminopropyl)trimethoxysilane
- Product Name(N,N-Diethyl-3-aminopropyl)trimethoxysilane
- CAS41051-80-3
- MFC10H25NO3Si
- MW235.4
- EINECS255-192-0
- MOL File41051-80-3.mol
Chemical Properties
| Boiling point | 120 °C/20 mmHg (lit.) |
| Density | 0.95 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 212 °F |
| storage temp. | 2-8°C |
| form | liquid |
| pka | 10.56±0.25(Predicted) |
| Specific Gravity | 0.934 |
| color | Colorless to Yellow |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C10H25NO3Si/c1-6-11(7-2)9-8-10-15(12-3,13-4)14-5/h6-10H2,1-5H3 |
| InChIKey | ZLDHYRXZZNDOKU-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)CC[Si](OC)(OC)OC |
| CAS DataBase Reference | 41051-80-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanamine, N,N-diethyl-3-(trimethoxysilyl)- (41051-80-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
