1,3,5-Triazine, 2,4,6-tris[1,1'-biphenyl]-4-yl-
- Product Name1,3,5-Triazine, 2,4,6-tris[1,1'-biphenyl]-4-yl-
- CAS31274-51-8
- MFC39H27N3
- MW537.65
- EINECS479-950-7
- MOL File31274-51-8.mol
Chemical Properties
| Melting point | 283 °C |
| Boiling point | 765.9±70.0 °C(Predicted) |
| Density | 1.166±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| pka | 1.66±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | 30ng/L at 21℃ |
| Cosmetics Ingredients Functions | UV ABSORBER UV FILTER LIGHT STABILIZER |
| InChIKey | CENPSTJGQOQKKW-UHFFFAOYSA-N |
| SMILES | N1=C(C2=CC=C(C3=CC=CC=C3)C=C2)N=C(C2=CC=C(C3=CC=CC=C3)C=C2)N=C1C1=CC=C(C2=CC=CC=C2)C=C1 |