Chemical Properties
| Melting point | 171-172.5° (US 4250094); mp 165-166° (DE 2201210) |
| Boiling point | 527.0±60.0 °C(Predicted) |
| Density | 1.31±0.1 g/cm3(Predicted) |
| storage temp. | -10 to -25°C |
| form | Solid |
| pka | pKa 6.2 (D2O/DClor D2O/NaOD ) (Uncertain);5.8±0.1(D2O/DClor D2O/NaOD ) (Uncertain) |
| color | White to off-white |
| InChI | 1S/C19H18ClN5/c1-24(2)12-18-23-22-17-11-21-19(13-6-4-3-5-7-13)15-10-14(20)8-9-16(15)25(17)18/h3-10H,11-12H2,1-2H3 |
| InChIKey | GJSLOMWRLALDCT-UHFFFAOYSA-N |
| SMILES | Clc1cc2c(cc1)[n]3c(nnc3CN(C)C)CN=C2c4ccccc4 |
Safety Information
| RIDADR | 3249 |
| WGK Germany | WGK 2 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |